C24H17N3O3 — CID 70790552
3-[(2S)-oxolan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 70790552) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 3-[(2S)-oxolan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 3-[(2S)-oxolan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 70790552 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-[(2S)-oxolan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c3ccccc3[nH]c1c1c2c2ccccc2n1[C@@H]1CCCO1 |
| InChI | InChI=1S/C24H17N3O3/c28-23-19-17-12-6-1-3-8-14(12)25-21(17)22-18(20(19)24(29)26-23)13-7-2-4-9-15(13)27(22)16-10-5-11-30-16/h1-4,6-9,16,25H,5,10-11H2,(H,26,28,29)/t16-/m0/s1 |
| InChIKey | PEGGPFVJQJUDEP-INIZCTEOSA-N |
| XLogP | 4.62 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|