C22H28FN5O4 — CID 70791075
(3R,4R)-1-[2-[2-amino-4-(2-fluoro-4-nitrophenoxy)-3-pyridinyl]propan-2-yl]-4-pyrrolidin-1-ylpyrrolidin-3-ol (PubChem CID 70791075) has the molecular formula C22H28FN5O4 and a molecular weight of 445.50 g/mol. Its IUPAC name is (3R,4R)-1-[2-[2-amino-4-(2-fluoro-4-nitrophenoxy)-3-pyridinyl]propan-2-yl]-4-pyrrolidin-1-ylpyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-[2-[2-amino-4-(2-fluoro-4-nitrophenoxy)-3-pyridinyl]propan-2-yl]-4-pyrrolidin-1-ylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 70791075 |
| Molecular Formula | C22H28FN5O4 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (3R,4R)-1-[2-[2-amino-4-(2-fluoro-4-nitrophenoxy)-3-pyridinyl]propan-2-yl]-4-pyrrolidin-1-ylpyrrolidin-3-ol |
| SMILES | CC(C)(c1c(Oc2ccc([N+](=O)[O-])cc2F)ccnc1N)N1C[C@@H](O)[C@H](N2CCCC2)C1 |
| InChI | InChI=1S/C22H28FN5O4/c1-22(2,27-12-16(17(29)13-27)26-9-3-4-10-26)20-19(7-8-25-21(20)24)32-18-6-5-14(28(30)31)11-15(18)23/h5-8,11,16-17,29H,3-4,9-10,12-13H2,1-2H3,(H2,24,25)/t16-,17-/m1/s1 |
| InChIKey | RAUWDYDTBVRTBR-IAGOWNOFSA-N |
| XLogP | 2.88 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|