C28H33NO9 — CID 70791142
(7S)-7-[(4-amino-5-hydroxy-6-methyloxan-2-yl)methyl]-6,9,11-trihydroxy-9-[(1S)-1-hydroxyethyl]-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 70791142) has the molecular formula C28H33NO9 and a molecular weight of 527.57 g/mol. Its IUPAC name is (7S)-7-[(4-amino-5-hydroxy-6-methyloxan-2-yl)methyl]-6,9,11-trihydroxy-9-[(1S)-1-hydroxyethyl]-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S)-7-[(4-amino-5-hydroxy-6-methyloxan-2-yl)methyl]-6,9,11-trihydroxy-9-[(1S)-1-hydroxyethyl]-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 70791142 |
| Molecular Formula | C28H33NO9 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (7S)-7-[(4-amino-5-hydroxy-6-methyloxan-2-yl)methyl]-6,9,11-trihydroxy-9-[(1S)-1-hydroxyethyl]-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(O)([C@H](C)O)C[C@@H]3CC1CC(N)C(O)C(C)O1 |
| InChI | InChI=1S/C28H33NO9/c1-11-23(31)17(29)8-14(38-11)7-13-9-28(36,12(2)30)10-16-19(13)26(34)22-21(25(16)33)24(32)15-5-4-6-18(37-3)20(15)27(22)35/h4-6,11-14,17,23,30-31,33-34,36H,7-10,29H2,1-3H3/t11?,12-,13-,14?,17?,23?,28?/m0/s1 |
| InChIKey | QXMNXDHPLVJJJP-VXGUKEKNSA-N |
| XLogP | 1.28 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|