C18H20N4O2 — CID 70792274
4-[(1-methoxy-4-tricyclo[3.3.1.02,7]non-2-enyl)amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 70792274) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[(1-methoxy-4-tricyclo[3.3.1.02,7]non-2-enyl)amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide.
| Compound Name | 4-[(1-methoxy-4-tricyclo[3.3.1.02,7]non-2-enyl)amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 70792274 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-[(1-methoxy-4-tricyclo[3.3.1.02,7]non-2-enyl)amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | COC12CC3CC(C1)C(Nc1c(C(N)=O)cnc4[nH]ccc14)C=C32 |
| InChI | InChI=1S/C18H20N4O2/c1-24-18-6-9-4-10(7-18)14(5-13(9)18)22-15-11-2-3-20-17(11)21-8-12(15)16(19)23/h2-3,5,8-10,14H,4,6-7H2,1H3,(H2,19,23)(H2,20,21,22) |
| InChIKey | JJNMJWHUXJIKKN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|