C21H19N5O2 — CID 70792580
4-(6,7-dihydro-1H-indol-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 70792580) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 4-(6,7-dihydro-1H-indol-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4-(6,7-dihydro-1H-indol-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 70792580 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-(6,7-dihydro-1H-indol-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | C1=C(c2nc(N3CCOCC3)c3oc4ncccc4c3n2)c2cc[nH]c2CC1 |
| InChI | InChI=1S/C21H19N5O2/c1-3-14(13-6-8-22-16(13)5-1)19-24-17-15-4-2-7-23-21(15)28-18(17)20(25-19)26-9-11-27-12-10-26/h2-4,6-8,22H,1,5,9-12H2 |
| InChIKey | OGOMHWSDHRQOGU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |