C16H17N3 — CID 70792646
(1R,4S)-2-(4-pyrimidin-2-ylphenyl)-2-azabicyclo[2.2.1]heptane (PubChem CID 70792646) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (1R,4S)-2-(4-pyrimidin-2-ylphenyl)-2-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,4S)-2-(4-pyrimidin-2-ylphenyl)-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 70792646 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (1R,4S)-2-(4-pyrimidin-2-ylphenyl)-2-azabicyclo[2.2.1]heptane |
| SMILES | c1cnc(-c2ccc(N3C[C@H]4CC[C@@H]3C4)cc2)nc1 |
| InChI | InChI=1S/C16H17N3/c1-8-17-16(18-9-1)13-3-6-14(7-4-13)19-11-12-2-5-15(19)10-12/h1,3-4,6-9,12,15H,2,5,10-11H2/t12-,15+/m0/s1 |
| InChIKey | CKPKLAVVGRUMGJ-SWLSCSKDSA-N |
| XLogP | 3.13 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |