C19H30O9 — CID 70793533
methyl (2R,4R,5R)-4-acetyloxy-6-[(1R,2R)-1,2-diacetyloxybutyl]-2,5-dimethyloxane-2-carboxylate (PubChem CID 70793533) has the molecular formula C19H30O9 and a molecular weight of 402.44 g/mol. Its IUPAC name is methyl (2R,4R,5R)-4-acetyloxy-6-[(1R,2R)-1,2-diacetyloxybutyl]-2,5-dimethyloxane-2-carboxylate.
| Compound Name | methyl (2R,4R,5R)-4-acetyloxy-6-[(1R,2R)-1,2-diacetyloxybutyl]-2,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 70793533 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | methyl (2R,4R,5R)-4-acetyloxy-6-[(1R,2R)-1,2-diacetyloxybutyl]-2,5-dimethyloxane-2-carboxylate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1O[C@@](C)(C(=O)OC)C[C@@H](OC(C)=O)[C@H]1C |
| InChI | InChI=1S/C19H30O9/c1-8-14(25-11(3)20)17(27-13(5)22)16-10(2)15(26-12(4)21)9-19(6,28-16)18(23)24-7/h10,14-17H,8-9H2,1-7H3/t10-,14-,15-,16?,17-,19-/m1/s1 |
| InChIKey | MEIHAUAGWQOYKL-SHVCXARQSA-N |
| XLogP | 1.55 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|