C26H42O10 — CID 70793555
methyl (3aR,7aR)-4-[(1R,2R)-1-acetyloxy-2-methylbutyl]-6-[[(3S,4S,6S)-6-methoxy-3,4,5-trimethyloxan-2-yl]methoxy]-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate (PubChem CID 70793555) has the molecular formula C26H42O10 and a molecular weight of 514.61 g/mol. Its IUPAC name is methyl (3aR,7aR)-4-[(1R,2R)-1-acetyloxy-2-methylbutyl]-6-[[(3S,4S,6S)-6-methoxy-3,4,5-trimethyloxan-2-yl]methoxy]-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate.
| Compound Name | methyl (3aR,7aR)-4-[(1R,2R)-1-acetyloxy-2-methylbutyl]-6-[[(3S,4S,6S)-6-methoxy-3,4,5-trimethyloxan-2-yl]methoxy]-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
|---|---|
| PubChem CID | 70793555 |
| Molecular Formula | C26H42O10 |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | methyl (3aR,7aR)-4-[(1R,2R)-1-acetyloxy-2-methylbutyl]-6-[[(3S,4S,6S)-6-methoxy-3,4,5-trimethyloxan-2-yl]methoxy]-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
| SMILES | CC[C@@H](C)[C@@H](OC(C)=O)C1OC(OCC2O[C@H](OC)C(C)[C@@H](C)[C@@H]2C)(C(=O)OC)C[C@H]2OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C26H42O10/c1-9-13(2)22(33-17(6)27)23-18-10-21(28)34-19(18)11-26(36-23,25(29)31-8)32-12-20-15(4)14(3)16(5)24(30-7)35-20/h13-16,18-20,22-24H,9-12H2,1-8H3/t13-,14+,15+,16?,18-,19-,20?,22-,23?,24+,26?/m1/s1 |
| InChIKey | QHMQIXANONXZBW-MTWVNPMWSA-N |
| XLogP | 2.85 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|