C20H27N3O2 — CID 70793676
ethyl 4-[[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (PubChem CID 70793676) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is ethyl 4-[[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate.
| Compound Name | ethyl 4-[[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 70793676 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | ethyl 4-[[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2[nH]ccc2c1N[C@H]1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C20H27N3O2/c1-5-25-18(24)14-11-22-17-13(7-9-21-17)16(14)23-15-10-12-6-8-20(15,4)19(12,2)3/h7,9,11-12,15H,5-6,8,10H2,1-4H3,(H2,21,22,23)/t12-,15+,20-/m1/s1 |
| InChIKey | GIJMKUOWNXVEMD-UFAGZECESA-N |
| XLogP | 4.37 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |