C21H22ClF2N5 — CID 70793977
N'-[5-chloro-4-[6-[(3,5-difluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]butane-1,4-diamine (PubChem CID 70793977) has the molecular formula C21H22ClF2N5 and a molecular weight of 417.89 g/mol. Its IUPAC name is N'-[5-chloro-4-[6-[(3,5-difluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]butane-1,4-diamine.
| Compound Name | N'-[5-chloro-4-[6-[(3,5-difluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 70793977 |
| Molecular Formula | C21H22ClF2N5 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N'-[5-chloro-4-[6-[(3,5-difluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]butane-1,4-diamine |
| SMILES | NCCCCNc1cc(-c2cccc(NCc3cc(F)cc(F)c3)n2)c(Cl)cn1 |
| InChI | InChI=1S/C21H22ClF2N5/c22-18-13-28-21(26-7-2-1-6-25)11-17(18)19-4-3-5-20(29-19)27-12-14-8-15(23)10-16(24)9-14/h3-5,8-11,13H,1-2,6-7,12,25H2,(H,26,28)(H,27,29) |
| InChIKey | LZMOOKCALNXDSH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|