C56H64O10 — CID 70794224
pentabenzyl 1,1,3,5,7,9-hexamethyldecane-1,3,5,7,9-pentacarboxylate (PubChem CID 70794224) has the molecular formula C56H64O10 and a molecular weight of 897.12 g/mol. Its IUPAC name is pentabenzyl 1,1,3,5,7,9-hexamethyldecane-1,3,5,7,9-pentacarboxylate.
| Compound Name | pentabenzyl 1,1,3,5,7,9-hexamethyldecane-1,3,5,7,9-pentacarboxylate |
|---|---|
| PubChem CID | 70794224 |
| Molecular Formula | C56H64O10 |
| Molecular Weight | 897.12 g/mol |
| Exact Mass | 896.45 |
| IUPAC Name | pentabenzyl 1,1,3,5,7,9-hexamethyldecane-1,3,5,7,9-pentacarboxylate |
| SMILES | CC(C)(CC(C)(CC(C)(CC(C)(CC(C)(C)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C56H64O10/c1-52(2,47(57)62-33-42-23-13-8-14-24-42)38-54(5,49(59)64-35-44-27-17-10-18-28-44)40-56(7,51(61)66-37-46-31-21-12-22-32-46)41-55(6,50(60)65-36-45-29-19-11-20-30-45)39-53(3,4)48(58)63-34-43-25-15-9-16-26-43/h8-32H,33-41H2,1-7H3 |
| InChIKey | BKMAJSYXSOOTDD-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.12 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|