C26H26F2IN7O — CID 70794327
N-[3-[2-[(3,4-difluorophenyl)methylamino]-9-[[(3R)-piperidin-3-yl]methyl]purin-8-yl]-4-iodophenyl]acetamide (PubChem CID 70794327) has the molecular formula C26H26F2IN7O and a molecular weight of 617.44 g/mol. Its IUPAC name is N-[3-[2-[(3,4-difluorophenyl)methylamino]-9-[[(3R)-piperidin-3-yl]methyl]purin-8-yl]-4-iodophenyl]acetamide.
| Compound Name | N-[3-[2-[(3,4-difluorophenyl)methylamino]-9-[[(3R)-piperidin-3-yl]methyl]purin-8-yl]-4-iodophenyl]acetamide |
|---|---|
| PubChem CID | 70794327 |
| Molecular Formula | C26H26F2IN7O |
| Molecular Weight | 617.44 g/mol |
| Exact Mass | 617.12 |
| IUPAC Name | N-[3-[2-[(3,4-difluorophenyl)methylamino]-9-[[(3R)-piperidin-3-yl]methyl]purin-8-yl]-4-iodophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(I)c(-c2nc3cnc(NCc4ccc(F)c(F)c4)nc3n2C[C@@H]2CCCNC2)c1 |
| InChI | InChI=1S/C26H26F2IN7O/c1-15(37)33-18-5-7-22(29)19(10-18)24-34-23-13-32-26(31-12-16-4-6-20(27)21(28)9-16)35-25(23)36(24)14-17-3-2-8-30-11-17/h4-7,9-10,13,17,30H,2-3,8,11-12,14H2,1H3,(H,33,37)(H,31,32,35)/t17-/m1/s1 |
| InChIKey | GVCUXIYKLNNNMK-QGZVFWFLSA-N |
| XLogP | 4.95 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|