C19H17F4N5O — CID 70794333
7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)piperidin-1-yl]-3-fluoro-2-methylpyrimido[1,2-b]pyridazin-4-one (PubChem CID 70794333) has the molecular formula C19H17F4N5O and a molecular weight of 407.37 g/mol. Its IUPAC name is 7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)piperidin-1-yl]-3-fluoro-2-methylpyrimido[1,2-b]pyridazin-4-one.
| Compound Name | 7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)piperidin-1-yl]-3-fluoro-2-methylpyrimido[1,2-b]pyridazin-4-one |
|---|---|
| PubChem CID | 70794333 |
| Molecular Formula | C19H17F4N5O |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)piperidin-1-yl]-3-fluoro-2-methylpyrimido[1,2-b]pyridazin-4-one |
| SMILES | Cc1nc2ccc(N3CCC(c4cc(F)c(F)cc4F)[C@@H](N)C3)nn2c(=O)c1F |
| InChI | InChI=1S/C19H17F4N5O/c1-9-18(23)19(29)28-16(25-9)2-3-17(26-28)27-5-4-10(15(24)8-27)11-6-13(21)14(22)7-12(11)20/h2-3,6-7,10,15H,4-5,8,24H2,1H3/t10?,15-/m0/s1 |
| InChIKey | NMUYRJYAXBBMBE-WRXSAAJRSA-N |
| XLogP | 2.28 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|