C40H63N9O14 — CID 70794466
6-amino-2-[2,6-bis[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]hexanoylamino]hexanamide (PubChem CID 70794466) has the molecular formula C40H63N9O14 and a molecular weight of 893.99 g/mol. Its IUPAC name is 6-amino-2-[2,6-bis[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]hexanoylamino]hexanamide.
| Compound Name | 6-amino-2-[2,6-bis[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]hexanoylamino]hexanamide |
|---|---|
| PubChem CID | 70794466 |
| Molecular Formula | C40H63N9O14 |
| Molecular Weight | 893.99 g/mol |
| Exact Mass | 893.45 |
| IUPAC Name | 6-amino-2-[2,6-bis[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]hexanoylamino]hexanamide |
| SMILES | NCCCCC(NC(=O)C(CCCCNC(=O)CCOCCOCCNC(=O)CCN1C(=O)C=CC1=O)NC(=O)CCOCCOCCNC(=O)CCN1C(=O)C=CC1=O)C(N)=O |
| InChI | InChI=1S/C40H63N9O14/c41-15-3-1-5-29(39(42)58)47-40(59)30(46-34(53)14-22-61-26-28-63-24-18-45-32(51)12-20-49-37(56)9-10-38(49)57)6-2-4-16-43-33(52)13-21-60-25-27-62-23-17-44-31(50)11-19-48-35(54)7-8-36(48)55/h7-10,29-30H,1-6,11-28,41H2,(H2,42,58)(H,43,52)(H,44,50)(H,45,51)(H,46,53)(H,47,59) |
| InChIKey | PKALAONZIOJAQL-UHFFFAOYSA-N |
| XLogP | -3.43 |
| TPSA | 326.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.99 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|