C17H22N2O4 — CID 70794815
(2S)-3-[5-(2-oxopropoxy)-1H-indol-3-yl]-2-(propan-2-ylamino)propanoic acid (PubChem CID 70794815) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is (2S)-3-[5-(2-oxopropoxy)-1H-indol-3-yl]-2-(propan-2-ylamino)propanoic acid.
| Compound Name | (2S)-3-[5-(2-oxopropoxy)-1H-indol-3-yl]-2-(propan-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 70794815 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (2S)-3-[5-(2-oxopropoxy)-1H-indol-3-yl]-2-(propan-2-ylamino)propanoic acid |
| SMILES | CC(=O)COc1ccc2[nH]cc(C[C@H](NC(C)C)C(=O)O)c2c1 |
| InChI | InChI=1S/C17H22N2O4/c1-10(2)19-16(17(21)22)6-12-8-18-15-5-4-13(7-14(12)15)23-9-11(3)20/h4-5,7-8,10,16,18-19H,6,9H2,1-3H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | KLISAGWUIAUVQD-INIZCTEOSA-N |
| XLogP | 2.13 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |