About 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole
5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole (PubChem CID 70794927) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole |
| PubChem CID | 70794927 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole |
| SMILES | CC1CC/C(=C/c2cnc[nH]2)C(C)C1C |
| InChI | InChI=1S/C13H20N2/c1-9-4-5-12(11(3)10(9)2)6-13-7-14-8-15-13/h6-11H,4-5H2,1-3H3,(H,14,15)/b12-6- |
| InChIKey | LMTWFHNEYYUZGZ-SDQBBNPISA-N |
| XLogP | 3.50 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole?
The IUPAC name of 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole (CID 70794927) is 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole.
What is the SMILES notation for 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole?
The canonical SMILES for 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole is CC1CC/C(=C/c2cnc[nH]2)C(C)C1C.
What is the InChIKey of 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole?
The InChIKey is LMTWFHNEYYUZGZ-SDQBBNPISA-N. The full InChI is InChI=1S/C13H20N2/c1-9-4-5-12(11(3)10(9)2)6-13-7-14-8-15-13/h6-11H,4-5H2,1-3H3,(H,14,15)/b12-6-.
What are the key properties of 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole?
5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole has a molecular weight of 204.32 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-(2,3,4-trimethylcyclohexylidene)methyl]-1H-imidazole is sourced from PubChem (CID 70794927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).