C22H20F3N5O2S — CID 70795639
3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)-N-[2-[[4-(trifluoromethoxy)phenyl]methylamino]ethyl]thiophene-2-carboxamide (PubChem CID 70795639) has the molecular formula C22H20F3N5O2S and a molecular weight of 475.50 g/mol. Its IUPAC name is 3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)-N-[2-[[4-(trifluoromethoxy)phenyl]methylamino]ethyl]thiophene-2-carboxamide.
| Compound Name | 3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)-N-[2-[[4-(trifluoromethoxy)phenyl]methylamino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 70795639 |
| Molecular Formula | C22H20F3N5O2S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)-N-[2-[[4-(trifluoromethoxy)phenyl]methylamino]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCNCc1ccc(OC(F)(F)F)cc1)c1sccc1Nc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C22H20F3N5O2S/c23-22(24,25)32-15-3-1-14(2-4-15)13-26-10-11-29-21(31)19-18(7-12-33-19)30-17-6-9-28-20-16(17)5-8-27-20/h1-9,12,26H,10-11,13H2,(H,29,31)(H2,27,28,30) |
| InChIKey | VTDCAPPVMCTTRJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|