C31H44P2 — CID 70795737
[2-[(1R)-1-bis(3,5-dimethylphenyl)phosphanylethyl]cyclopenta-1,4-dien-1-yl]-ditert-butylphosphane (PubChem CID 70795737) has the molecular formula C31H44P2 and a molecular weight of 478.64 g/mol. Its IUPAC name is [2-[(1R)-1-bis(3,5-dimethylphenyl)phosphanylethyl]cyclopenta-1,4-dien-1-yl]-ditert-butylphosphane.
| Compound Name | [2-[(1R)-1-bis(3,5-dimethylphenyl)phosphanylethyl]cyclopenta-1,4-dien-1-yl]-ditert-butylphosphane |
|---|---|
| PubChem CID | 70795737 |
| Molecular Formula | C31H44P2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | [2-[(1R)-1-bis(3,5-dimethylphenyl)phosphanylethyl]cyclopenta-1,4-dien-1-yl]-ditert-butylphosphane |
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)[C@H](C)C2=C(P(C(C)(C)C)C(C)(C)C)C=CC2)c1 |
| InChI | InChI=1S/C31H44P2/c1-21-15-22(2)18-26(17-21)32(27-19-23(3)16-24(4)20-27)25(5)28-13-12-14-29(28)33(30(6,7)8)31(9,10)11/h12,14-20,25H,13H2,1-11H3/t25-/m1/s1 |
| InChIKey | SHKZTOULLHNCOG-RUZDIDTESA-N |
| XLogP | 9.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|