C41H48O2P2 — CID 70795829
[2-[(1R)-1-bis(3,5-dimethylphenyl)phosphanylethyl]cyclopenta-1,4-dien-1-yl]-bis(2-propan-2-yloxyphenyl)phosphane (PubChem CID 70795829) has the molecular formula C41H48O2P2 and a molecular weight of 634.78 g/mol. Its IUPAC name is [2-[(1R)-1-bis(3,5-dimethylphenyl)phosphanylethyl]cyclopenta-1,4-dien-1-yl]-bis(2-propan-2-yloxyphenyl)phosphane.
| Compound Name | [2-[(1R)-1-bis(3,5-dimethylphenyl)phosphanylethyl]cyclopenta-1,4-dien-1-yl]-bis(2-propan-2-yloxyphenyl)phosphane |
|---|---|
| PubChem CID | 70795829 |
| Molecular Formula | C41H48O2P2 |
| Molecular Weight | 634.78 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | [2-[(1R)-1-bis(3,5-dimethylphenyl)phosphanylethyl]cyclopenta-1,4-dien-1-yl]-bis(2-propan-2-yloxyphenyl)phosphane |
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)[C@H](C)C2=C(P(c3ccccc3OC(C)C)c3ccccc3OC(C)C)C=CC2)c1 |
| InChI | InChI=1S/C41H48O2P2/c1-27(2)42-37-16-10-12-18-40(37)45(41-19-13-11-17-38(41)43-28(3)4)39-20-14-15-36(39)33(9)44(34-23-29(5)21-30(6)24-34)35-25-31(7)22-32(8)26-35/h10-14,16-28,33H,15H2,1-9H3/t33-/m1/s1 |
| InChIKey | VLFYNTSNFSSWPM-MGBGTMOVSA-N |
| XLogP | 9.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.78 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|