C22H28N2O5S — CID 7079618
N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-methoxyphenoxy)acetamide (PubChem CID 7079618) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 7079618 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)N(Cc1ccc(N(C)C)cc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H28N2O5S/c1-23(2)18-10-8-17(9-11-18)14-24(19-12-13-30(26,27)16-19)22(25)15-29-21-7-5-4-6-20(21)28-3/h4-11,19H,12-16H2,1-3H3/t19-/m0/s1 |
| InChIKey | GDUOUTACDKELPR-IBGZPJMESA-N |
| XLogP | 2.36 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|