About 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid
2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid (PubChem CID 70797532) has the molecular formula C19H19NO2
and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid.
Molecular Properties
| Compound Name | 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid |
| PubChem CID | 70797532 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid |
| SMILES | CN1CC=C(C(C(=O)O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C19H19NO2/c1-20-13-12-17(14-20)19(18(21)22,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-12H,13-14H2,1H3,(H,21,22) |
| InChIKey | SDYOMLRMZRXXMT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid?
The IUPAC name of 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid (CID 70797532) is 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid.
What is the SMILES notation for 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid?
The canonical SMILES for 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid is CN1CC=C(C(C(=O)O)(c2ccccc2)c2ccccc2)C1.
What is the InChIKey of 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid?
The InChIKey is SDYOMLRMZRXXMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO2/c1-20-13-12-17(14-20)19(18(21)22,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-12H,13-14H2,1H3,(H,21,22).
What are the key properties of 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid?
2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid has a molecular weight of 293.37 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-2,5-dihydropyrrol-3-yl)-2,2-diphenylacetic acid is sourced from PubChem (CID 70797532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).