C30H43F2NO — CID 70797855
3-(2,3-difluoro-4-propylphenyl)-6-[6-(4-pentylcyclohexyl)oxan-3-yl]-1,2-dihydropyridine (PubChem CID 70797855) has the molecular formula C30H43F2NO and a molecular weight of 471.68 g/mol. Its IUPAC name is 3-(2,3-difluoro-4-propylphenyl)-6-[6-(4-pentylcyclohexyl)oxan-3-yl]-1,2-dihydropyridine.
| Compound Name | 3-(2,3-difluoro-4-propylphenyl)-6-[6-(4-pentylcyclohexyl)oxan-3-yl]-1,2-dihydropyridine |
|---|---|
| PubChem CID | 70797855 |
| Molecular Formula | C30H43F2NO |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | 3-(2,3-difluoro-4-propylphenyl)-6-[6-(4-pentylcyclohexyl)oxan-3-yl]-1,2-dihydropyridine |
| SMILES | CCCCCC1CCC(C2CCC(C3=CC=C(c4ccc(CCC)c(F)c4F)CN3)CO2)CC1 |
| InChI | InChI=1S/C30H43F2NO/c1-3-5-6-8-21-9-11-22(12-10-21)28-18-15-25(20-34-28)27-17-14-24(19-33-27)26-16-13-23(7-4-2)29(31)30(26)32/h13-14,16-17,21-22,25,28,33H,3-12,15,18-20H2,1-2H3 |
| InChIKey | SOAICMULCANZFX-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|