C9H11N3O3 — CID 70798134
N-(2-amino-2-oxoethyl)-5-methoxypyridine-2-carboxamide (PubChem CID 70798134) has the molecular formula C9H11N3O3 and a molecular weight of 209.21 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-5-methoxypyridine-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 70798134 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-5-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(C(=O)NCC(N)=O)nc1 |
| InChI | InChI=1S/C9H11N3O3/c1-15-6-2-3-7(11-4-6)9(14)12-5-8(10)13/h2-4H,5H2,1H3,(H2,10,13)(H,12,14) |
| InChIKey | FLSTWWYBYKJWDD-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |