About 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine
5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine (PubChem CID 70798491) has the molecular formula C22H23N7O2
and a molecular weight of 417.47 g/mol. Its IUPAC name is 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine |
| PubChem CID | 70798491 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2cc(-c3ccc4nc(N)c(N5CC(N6CCOCC6)C5)nc4c3)ccc2o1 |
| InChI | InChI=1S/C22H23N7O2/c23-20-21(29-11-15(12-29)28-5-7-30-8-6-28)26-17-9-13(1-3-16(17)25-20)14-2-4-19-18(10-14)27-22(24)31-19/h1-4,9-10,15H,5-8,11-12H2,(H2,23,25)(H2,24,27) |
| InChIKey | ZHGVWCYSVRINFL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine?
The IUPAC name of 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine (CID 70798491) is 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine.
What is the SMILES notation for 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine?
The canonical SMILES for 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine is Nc1nc2cc(-c3ccc4nc(N)c(N5CC(N6CCOCC6)C5)nc4c3)ccc2o1.
What is the InChIKey of 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine?
The InChIKey is ZHGVWCYSVRINFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N7O2/c23-20-21(29-11-15(12-29)28-5-7-30-8-6-28)26-17-9-13(1-3-16(17)25-20)14-2-4-19-18(10-14)27-22(24)31-19/h1-4,9-10,15H,5-8,11-12H2,(H2,23,25)(H2,24,27).
What are the key properties of 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine?
5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine has a molecular weight of 417.47 g/mol, XLogP of 2.12, 3 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-amino-3-(3-morpholin-4-ylazetidin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine is sourced from PubChem (CID 70798491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).