About 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine
5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine (PubChem CID 70798540) has the molecular formula C20H17F3N6O
and a molecular weight of 414.39 g/mol. Its IUPAC name is 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine |
| PubChem CID | 70798540 |
| Molecular Formula | C20H17F3N6O |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2cc(-c3ccc4ncc(N5CCNC(C(F)(F)F)C5)nc4c3)ccc2o1 |
| InChI | InChI=1S/C20H17F3N6O/c21-20(22,23)17-10-29(6-5-25-17)18-9-26-13-3-1-11(7-14(13)27-18)12-2-4-16-15(8-12)28-19(24)30-16/h1-4,7-9,17,25H,5-6,10H2,(H2,24,28) |
| InChIKey | BRRMDVPTDUISIC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine?
The IUPAC name of 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine (CID 70798540) is 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine.
What is the SMILES notation for 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine?
The canonical SMILES for 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine is Nc1nc2cc(-c3ccc4ncc(N5CCNC(C(F)(F)F)C5)nc4c3)ccc2o1.
What is the InChIKey of 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine?
The InChIKey is BRRMDVPTDUISIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F3N6O/c21-20(22,23)17-10-29(6-5-25-17)18-9-26-13-3-1-11(7-14(13)27-18)12-2-4-16-15(8-12)28-19(24)30-16/h1-4,7-9,17,25H,5-6,10H2,(H2,24,28).
What are the key properties of 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine?
5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine has a molecular weight of 414.39 g/mol, XLogP of 3.36, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[3-(trifluoromethyl)piperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine is sourced from PubChem (CID 70798540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).