About 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine
7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine (PubChem CID 70798558) has the molecular formula C20H20N6O
and a molecular weight of 360.42 g/mol. Its IUPAC name is 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine |
| PubChem CID | 70798558 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine |
| SMILES | C[C@H]1CN(c2cnc3ccc(-c4cccc5nc(N)oc45)cc3n2)CCN1 |
| InChI | InChI=1S/C20H20N6O/c1-12-11-26(8-7-22-12)18-10-23-15-6-5-13(9-17(15)24-18)14-3-2-4-16-19(14)27-20(21)25-16/h2-6,9-10,12,22H,7-8,11H2,1H3,(H2,21,25)/t12-/m0/s1 |
| InChIKey | ZWPFCMLDODUSCK-LBPRGKRZSA-N |
| XLogP | 2.82 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine?
The IUPAC name of 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine (CID 70798558) is 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine.
What is the SMILES notation for 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine?
The canonical SMILES for 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine is C[C@H]1CN(c2cnc3ccc(-c4cccc5nc(N)oc45)cc3n2)CCN1.
What is the InChIKey of 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine?
The InChIKey is ZWPFCMLDODUSCK-LBPRGKRZSA-N. The full InChI is InChI=1S/C20H20N6O/c1-12-11-26(8-7-22-12)18-10-23-15-6-5-13(9-17(15)24-18)14-3-2-4-16-19(14)27-20(21)25-16/h2-6,9-10,12,22H,7-8,11H2,1H3,(H2,21,25)/t12-/m0/s1.
What are the key properties of 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine?
7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine has a molecular weight of 360.42 g/mol, XLogP of 2.82, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-[(3S)-3-methylpiperazin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine is sourced from PubChem (CID 70798558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).