C18H17BrF2N2O3 — CID 70798912
5-bromo-3-[[2,6-difluoro-3-(2-methoxyethoxy)phenyl]-methoxymethyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 70798912) has the molecular formula C18H17BrF2N2O3 and a molecular weight of 427.25 g/mol. Its IUPAC name is 5-bromo-3-[[2,6-difluoro-3-(2-methoxyethoxy)phenyl]-methoxymethyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-bromo-3-[[2,6-difluoro-3-(2-methoxyethoxy)phenyl]-methoxymethyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 70798912 |
| Molecular Formula | C18H17BrF2N2O3 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 5-bromo-3-[[2,6-difluoro-3-(2-methoxyethoxy)phenyl]-methoxymethyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COCCOc1ccc(F)c(C(OC)c2c[nH]c3ncc(Br)cc23)c1F |
| InChI | InChI=1S/C18H17BrF2N2O3/c1-24-5-6-26-14-4-3-13(20)15(16(14)21)17(25-2)12-9-23-18-11(12)7-10(19)8-22-18/h3-4,7-9,17H,5-6H2,1-2H3,(H,22,23) |
| InChIKey | AJHVCYXAOKHRGD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|