C22H23ClN2O3 — CID 70799090
2-[[1-[(4-chlorophenyl)methyl]indole-7-carbonyl]amino]hexanoic acid (PubChem CID 70799090) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 2-[[1-[(4-chlorophenyl)methyl]indole-7-carbonyl]amino]hexanoic acid.
| Compound Name | 2-[[1-[(4-chlorophenyl)methyl]indole-7-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 70799090 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[[1-[(4-chlorophenyl)methyl]indole-7-carbonyl]amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)c1cccc2ccn(Cc3ccc(Cl)cc3)c12)C(=O)O |
| InChI | InChI=1S/C22H23ClN2O3/c1-2-3-7-19(22(27)28)24-21(26)18-6-4-5-16-12-13-25(20(16)18)14-15-8-10-17(23)11-9-15/h4-6,8-13,19H,2-3,7,14H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | JHGUJWDFDICIFL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |