About N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide
N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide (PubChem CID 70799422) has the molecular formula C14H29NO2S
and a molecular weight of 275.46 g/mol. Its IUPAC name is N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide |
| PubChem CID | 70799422 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide |
| SMILES | CC(C)(C)[C@@H]1C[C@@H]1CCN(C(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C14H29NO2S/c1-13(2,3)12-10-11(12)8-9-15(14(4,5)6)18(7,16)17/h11-12H,8-10H2,1-7H3/t11-,12+/m0/s1 |
| InChIKey | YPBSKITYFXHLEL-NWDGAFQWSA-N |
| XLogP | 3.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide?
The IUPAC name of N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide (CID 70799422) is N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide.
What is the SMILES notation for N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide?
The canonical SMILES for N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide is CC(C)(C)[C@@H]1C[C@@H]1CCN(C(C)(C)C)S(C)(=O)=O.
What is the InChIKey of N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide?
The InChIKey is YPBSKITYFXHLEL-NWDGAFQWSA-N. The full InChI is InChI=1S/C14H29NO2S/c1-13(2,3)12-10-11(12)8-9-15(14(4,5)6)18(7,16)17/h11-12H,8-10H2,1-7H3/t11-,12+/m0/s1.
What are the key properties of N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide?
N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide has a molecular weight of 275.46 g/mol, XLogP of 3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-[2-[(1R,2R)-2-tert-butylcyclopropyl]ethyl]methanesulfonamide is sourced from PubChem (CID 70799422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).