About N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide
N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide (PubChem CID 70799428) has the molecular formula C15H31NO2S
and a molecular weight of 289.49 g/mol. Its IUPAC name is N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide |
| PubChem CID | 70799428 |
| Molecular Formula | C15H31NO2S |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide |
| SMILES | CC(C)(C)CCCCN(C(C)(C)C)S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C15H31NO2S/c1-14(2,3)11-7-8-12-16(15(4,5)6)19(17,18)13-9-10-13/h13H,7-12H2,1-6H3 |
| InChIKey | OQIZAWHDILWWBE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide?
The IUPAC name of N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide (CID 70799428) is N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide.
What is the SMILES notation for N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide?
The canonical SMILES for N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide is CC(C)(C)CCCCN(C(C)(C)C)S(=O)(=O)C1CC1.
What is the InChIKey of N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide?
The InChIKey is OQIZAWHDILWWBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2S/c1-14(2,3)11-7-8-12-16(15(4,5)6)19(17,18)13-9-10-13/h13H,7-12H2,1-6H3.
What are the key properties of N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide?
N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide has a molecular weight of 289.49 g/mol, XLogP of 3.80, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-(5,5-dimethylhexyl)cyclopropanesulfonamide is sourced from PubChem (CID 70799428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).