C20H13ClN3O2S2+ — CID 70799629
13-[(2-chloro-1,3-thiazol-5-yl)methyl]-12-hydroxy-11-phenyl-5-thia-9-aza-13-azoniatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,11-pentaen-10-one (PubChem CID 70799629) has the molecular formula C20H13ClN3O2S2+ and a molecular weight of 426.93 g/mol. Its IUPAC name is 13-[(2-chloro-1,3-thiazol-5-yl)methyl]-12-hydroxy-11-phenyl-5-thia-9-aza-13-azoniatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,11-pentaen-10-one.
| Compound Name | 13-[(2-chloro-1,3-thiazol-5-yl)methyl]-12-hydroxy-11-phenyl-5-thia-9-aza-13-azoniatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,11-pentaen-10-one |
|---|---|
| PubChem CID | 70799629 |
| Molecular Formula | C20H13ClN3O2S2+ |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 13-[(2-chloro-1,3-thiazol-5-yl)methyl]-12-hydroxy-11-phenyl-5-thia-9-aza-13-azoniatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,11-pentaen-10-one |
| SMILES | O=c1c(-c2ccccc2)c(O)[n+](Cc2cnc(Cl)s2)c2c3ccsc3ccn12 |
| InChI | InChI=1S/C20H12ClN3O2S2/c21-20-22-10-13(28-20)11-24-17-14-7-9-27-15(14)6-8-23(17)18(25)16(19(24)26)12-4-2-1-3-5-12/h1-10H,11H2/p+1 |
| InChIKey | KOPNUDUESZGJSI-UHFFFAOYSA-O |
| XLogP | 4.33 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|