About N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide
N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide (PubChem CID 70799734) has the molecular formula C16H33FN2O2S
and a molecular weight of 336.52 g/mol. Its IUPAC name is N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide |
| PubChem CID | 70799734 |
| Molecular Formula | C16H33FN2O2S |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide |
| SMILES | CC(N1CC(F)CC1CN(C(C)(C)C)S(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C16H33FN2O2S/c1-12(15(2,3)4)18-10-13(17)9-14(18)11-19(16(5,6)7)22(8,20)21/h12-14H,9-11H2,1-8H3 |
| InChIKey | MYQGMHMYNAAFNF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide?
The IUPAC name of N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide (CID 70799734) is N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide.
What is the SMILES notation for N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide?
The canonical SMILES for N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide is CC(N1CC(F)CC1CN(C(C)(C)C)S(C)(=O)=O)C(C)(C)C.
What is the InChIKey of N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide?
The InChIKey is MYQGMHMYNAAFNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33FN2O2S/c1-12(15(2,3)4)18-10-13(17)9-14(18)11-19(16(5,6)7)22(8,20)21/h12-14H,9-11H2,1-8H3.
What are the key properties of N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide?
N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide has a molecular weight of 336.52 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-[[1-(3,3-dimethylbutan-2-yl)-4-fluoropyrrolidin-2-yl]methyl]methanesulfonamide is sourced from PubChem (CID 70799734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).