About tetracene
tetracene (PubChem CID 7080) has the molecular formula C18H12
and a molecular weight of 228.29 g/mol. Its IUPAC name is tetracene.
Molecular Properties
| Compound Name | tetracene |
| PubChem CID | 7080 |
| Molecular Formula | C18H12 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | tetracene |
| SMILES | c1ccc2cc3cc4ccccc4cc3cc2c1 |
| InChI | InChI=1S/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
| InChIKey | IFLREYGFSNHWGE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze tetracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracene?
The IUPAC name of tetracene (CID 7080) is tetracene.
What is the SMILES notation for tetracene?
The canonical SMILES for tetracene is c1ccc2cc3cc4ccccc4cc3cc2c1.
What is the InChIKey of tetracene?
The InChIKey is IFLREYGFSNHWGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H.
What are the key properties of tetracene?
tetracene has a molecular weight of 228.29 g/mol, XLogP of 5.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetracene is sourced from PubChem (CID 7080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).