C14H19N3O2S — CID 70800012
5,11-di(propan-2-yl)-4λ6-thia-2,8,10-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,7,11-tetraene 4,4-dioxide (PubChem CID 70800012) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 5,11-di(propan-2-yl)-4λ6-thia-2,8,10-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,7,11-tetraene 4,4-dioxide.
| Compound Name | 5,11-di(propan-2-yl)-4λ6-thia-2,8,10-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,7,11-tetraene 4,4-dioxide |
|---|---|
| PubChem CID | 70800012 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 5,11-di(propan-2-yl)-4λ6-thia-2,8,10-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,7,11-tetraene 4,4-dioxide |
| SMILES | CC(C)c1cc2nc3c(nc2[nH]1)CC(C(C)C)S3(=O)=O |
| InChI | InChI=1S/C14H19N3O2S/c1-7(2)9-5-10-13(15-9)16-11-6-12(8(3)4)20(18,19)14(11)17-10/h5,7-8,12H,6H2,1-4H3,(H,15,16) |
| InChIKey | IVAIYRVAYIWAJJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |