C17H13N3 — CID 70800051
9-methyl-3-pyridin-2-ylpyrido[3,4-b]indole (PubChem CID 70800051) has the molecular formula C17H13N3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 9-methyl-3-pyridin-2-ylpyrido[3,4-b]indole.
| Compound Name | 9-methyl-3-pyridin-2-ylpyrido[3,4-b]indole |
|---|---|
| PubChem CID | 70800051 |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 9-methyl-3-pyridin-2-ylpyrido[3,4-b]indole |
| SMILES | Cn1c2ccccc2c2cc(-c3ccccn3)ncc21 |
| InChI | InChI=1S/C17H13N3/c1-20-16-8-3-2-6-12(16)13-10-15(19-11-17(13)20)14-7-4-5-9-18-14/h2-11H,1H3 |
| InChIKey | WVSMPWCLADPQIO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |