C35H42BN3O2 — CID 70800079
2,4-bis(4-tert-butylphenyl)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 70800079) has the molecular formula C35H42BN3O2 and a molecular weight of 547.55 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 70800079 |
| Molecular Formula | C35H42BN3O2 |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 547.34 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C35H42BN3O2/c1-32(2,3)26-17-11-23(12-18-26)29-37-30(24-13-19-27(20-14-24)33(4,5)6)39-31(38-29)25-15-21-28(22-16-25)36-40-34(7,8)35(9,10)41-36/h11-22H,1-10H3 |
| InChIKey | TUHFNWIWWDDNSI-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|