C9H18O5 — CID 70800080
(2S,4R,5S)-2-methoxy-2,3,6-trimethyloxane-3,4,5-triol (PubChem CID 70800080) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2S,4R,5S)-2-methoxy-2,3,6-trimethyloxane-3,4,5-triol.
| Compound Name | (2S,4R,5S)-2-methoxy-2,3,6-trimethyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 70800080 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (2S,4R,5S)-2-methoxy-2,3,6-trimethyloxane-3,4,5-triol |
| SMILES | CO[C@@]1(C)OC(C)[C@@H](O)[C@@H](O)C1(C)O |
| InChI | InChI=1S/C9H18O5/c1-5-6(10)7(11)8(2,12)9(3,13-4)14-5/h5-7,10-12H,1-4H3/t5?,6-,7-,8?,9+/m1/s1 |
| InChIKey | GZVYJDBWZPDSFD-NHXOTDAESA-N |
| XLogP | -0.76 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |