C22H22FN3O3S — CID 70800723
3-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-fluorophenyl)-9-methylsulfonyl-5,6,7,8-tetrahydrofuro[3,2-h][1]benzazepine (PubChem CID 70800723) has the molecular formula C22H22FN3O3S and a molecular weight of 427.50 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-fluorophenyl)-9-methylsulfonyl-5,6,7,8-tetrahydrofuro[3,2-h][1]benzazepine.
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-fluorophenyl)-9-methylsulfonyl-5,6,7,8-tetrahydrofuro[3,2-h][1]benzazepine |
|---|---|
| PubChem CID | 70800723 |
| Molecular Formula | C22H22FN3O3S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-fluorophenyl)-9-methylsulfonyl-5,6,7,8-tetrahydrofuro[3,2-h][1]benzazepine |
| SMILES | CS(=O)(=O)N1CCCCc2cc3c(C4=NCCN4)c(-c4ccc(F)cc4)oc3cc21 |
| InChI | InChI=1S/C22H22FN3O3S/c1-30(27,28)26-11-3-2-4-15-12-17-19(13-18(15)26)29-21(14-5-7-16(23)8-6-14)20(17)22-24-9-10-25-22/h5-8,12-13H,2-4,9-11H2,1H3,(H,24,25) |
| InChIKey | IBURBNJEPOGTIX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |