C33H39F3N2O4 — CID 70801037
1-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-(3,4-dimethoxyphenyl)piperidin-4-ol (PubChem CID 70801037) has the molecular formula C33H39F3N2O4 and a molecular weight of 584.68 g/mol. Its IUPAC name is 1-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-(3,4-dimethoxyphenyl)piperidin-4-ol.
| Compound Name | 1-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-(3,4-dimethoxyphenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 70801037 |
| Molecular Formula | C33H39F3N2O4 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 1-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-(3,4-dimethoxyphenyl)piperidin-4-ol |
| SMILES | COc1ccc(C2(O)CCN(C[C@H]3CC[C@@H]4[C@H](O3)c3cc(C(F)(F)F)ccc3N[C@H]4C3C=CC=CC3)CC2)cc1OC |
| InChI | InChI=1S/C33H39F3N2O4/c1-40-28-13-9-22(19-29(28)41-2)32(39)14-16-38(17-15-32)20-24-10-11-25-30(21-6-4-3-5-7-21)37-27-12-8-23(33(34,35)36)18-26(27)31(25)42-24/h3-6,8-9,12-13,18-19,21,24-25,30-31,37,39H,7,10-11,14-17,20H2,1-2H3/t21?,24-,25+,30+,31+/m1/s1 |
| InChIKey | KMUPECFTCVDDCS-LYFMVBMHSA-N |
| XLogP | 6.47 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |