C24H31ClFN3O — CID 70801092
(2R,4aS,5S,10bS)-9-chloro-5-cyclohexa-2,4-dien-1-yl-7-fluoro-2-[(4-methylpiperazin-1-yl)methyl]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 70801092) has the molecular formula C24H31ClFN3O and a molecular weight of 431.98 g/mol. Its IUPAC name is (2R,4aS,5S,10bS)-9-chloro-5-cyclohexa-2,4-dien-1-yl-7-fluoro-2-[(4-methylpiperazin-1-yl)methyl]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (2R,4aS,5S,10bS)-9-chloro-5-cyclohexa-2,4-dien-1-yl-7-fluoro-2-[(4-methylpiperazin-1-yl)methyl]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 70801092 |
| Molecular Formula | C24H31ClFN3O |
| Molecular Weight | 431.98 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (2R,4aS,5S,10bS)-9-chloro-5-cyclohexa-2,4-dien-1-yl-7-fluoro-2-[(4-methylpiperazin-1-yl)methyl]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CN1CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(Cl)cc(F)c2N[C@H]3C2C=CC=CC2)CC1 |
| InChI | InChI=1S/C24H31ClFN3O/c1-28-9-11-29(12-10-28)15-18-7-8-19-22(16-5-3-2-4-6-16)27-23-20(24(19)30-18)13-17(25)14-21(23)26/h2-5,13-14,16,18-19,22,24,27H,6-12,15H2,1H3/t16?,18-,19+,22+,24+/m1/s1 |
| InChIKey | NZBCUFXVIIYLKD-OTSHEHKPSA-N |
| XLogP | 4.49 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.98 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |