C23H29ClFN3O2 — CID 70801176
N-[2-[[(2R,4aS,5S,10bS)-9-chloro-5-cyclohexa-2,4-dien-1-yl-7-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]ethyl]acetamide (PubChem CID 70801176) has the molecular formula C23H29ClFN3O2 and a molecular weight of 433.96 g/mol. Its IUPAC name is N-[2-[[(2R,4aS,5S,10bS)-9-chloro-5-cyclohexa-2,4-dien-1-yl-7-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]ethyl]acetamide.
| Compound Name | N-[2-[[(2R,4aS,5S,10bS)-9-chloro-5-cyclohexa-2,4-dien-1-yl-7-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 70801176 |
| Molecular Formula | C23H29ClFN3O2 |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | N-[2-[[(2R,4aS,5S,10bS)-9-chloro-5-cyclohexa-2,4-dien-1-yl-7-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC[C@H]1CC[C@@H]2[C@H](O1)c1cc(Cl)cc(F)c1N[C@H]2C1C=CC=CC1 |
| InChI | InChI=1S/C23H29ClFN3O2/c1-14(29)27-10-9-26-13-17-7-8-18-21(15-5-3-2-4-6-15)28-22-19(23(18)30-17)11-16(24)12-20(22)25/h2-5,11-12,15,17-18,21,23,26,28H,6-10,13H2,1H3,(H,27,29)/t15?,17-,18+,21+,23+/m1/s1 |
| InChIKey | SOGZPIXYSKHLNR-ZXJWNVHSSA-N |
| XLogP | 3.97 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|