C27H37NO3 — CID 70801285
[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl pentanoate (PubChem CID 70801285) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is [(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl pentanoate.
| Compound Name | [(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 70801285 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | [(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(C)C)ccc1N[C@H]2C1C=CC=CC1 |
| InChI | InChI=1S/C27H37NO3/c1-4-5-11-25(29)30-17-21-13-14-22-26(19-9-7-6-8-10-19)28-24-15-12-20(18(2)3)16-23(24)27(22)31-21/h6-9,12,15-16,18-19,21-22,26-28H,4-5,10-11,13-14,17H2,1-3H3/t19?,21-,22+,26+,27+/m1/s1 |
| InChIKey | USBCQFYXHJLTFX-OXTYXFMUSA-N |
| XLogP | 6.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |