C15H22BN3O3 — CID 70801534
3-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazo[4,5-b]pyridin-2-one (PubChem CID 70801534) has the molecular formula C15H22BN3O3 and a molecular weight of 303.17 g/mol. Its IUPAC name is 3-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 3-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 70801534 |
| Molecular Formula | C15H22BN3O3 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 3-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazo[4,5-b]pyridin-2-one |
| SMILES | CC(C)n1c(=O)[nH]c2cc(B3OC(C)(C)C(C)(C)O3)cnc21 |
| InChI | InChI=1S/C15H22BN3O3/c1-9(2)19-12-11(18-13(19)20)7-10(8-17-12)16-21-14(3,4)15(5,6)22-16/h7-9H,1-6H3,(H,18,20) |
| InChIKey | HLVAMZGIALTHBB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|