About 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol
2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol (PubChem CID 70802058) has the molecular formula C10H16F2N4O
and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol |
| PubChem CID | 70802058 |
| Molecular Formula | C10H16F2N4O |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol |
| SMILES | Nc1cnn(CCO)c1N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C10H16F2N4O/c11-10(12)2-1-3-15(7-10)9-8(13)6-14-16(9)4-5-17/h6,17H,1-5,7,13H2 |
| InChIKey | CYIRLSLYUSDXAQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol?
The IUPAC name of 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol (CID 70802058) is 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol.
What is the SMILES notation for 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol?
The canonical SMILES for 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol is Nc1cnn(CCO)c1N1CCCC(F)(F)C1.
What is the InChIKey of 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol?
The InChIKey is CYIRLSLYUSDXAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2N4O/c11-10(12)2-1-3-15(7-10)9-8(13)6-14-16(9)4-5-17/h6,17H,1-5,7,13H2.
What are the key properties of 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol?
2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol has a molecular weight of 246.26 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-amino-5-(3,3-difluoropiperidin-1-yl)pyrazol-1-yl]ethanol is sourced from PubChem (CID 70802058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).