C30H36F3N3O4 — CID 70802323
4-[[(1S,2S)-2-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-8-hydroxy-9-(trifluoromethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 70802323) has the molecular formula C30H36F3N3O4 and a molecular weight of 559.63 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-8-hydroxy-9-(trifluoromethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4-[[(1S,2S)-2-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-8-hydroxy-9-(trifluoromethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 70802323 |
| Molecular Formula | C30H36F3N3O4 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 4-[[(1S,2S)-2-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-8-hydroxy-9-(trifluoromethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1C2C3CC(C2C(=O)N1C[C@H]1CCCC[C@@H]1CN1CCC(c2noc4ccccc24)CC1)C(C(F)(F)F)C3O |
| InChI | InChI=1S/C30H36F3N3O4/c31-30(32,33)25-20-13-21(27(25)37)24-23(20)28(38)36(29(24)39)15-18-6-2-1-5-17(18)14-35-11-9-16(10-12-35)26-19-7-3-4-8-22(19)40-34-26/h3-4,7-8,16-18,20-21,23-25,27,37H,1-2,5-6,9-15H2/t17-,18-,20?,21?,23?,24?,25?,27?/m1/s1 |
| InChIKey | BPQMAFLULFWPKP-DXPYFOBKSA-N |
| XLogP | 4.60 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|