About (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea
(5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea (PubChem CID 70802426) has the molecular formula C10H15ClN2O
and a molecular weight of 214.70 g/mol. Its IUPAC name is (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea.
Molecular Properties
| Compound Name | (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea |
| PubChem CID | 70802426 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea |
| SMILES | CCC1CC=C(CNC(N)=O)C=C1Cl |
| InChI | InChI=1S/C10H15ClN2O/c1-2-8-4-3-7(5-9(8)11)6-13-10(12)14/h3,5,8H,2,4,6H2,1H3,(H3,12,13,14) |
| InChIKey | CQZJNOXVVAPGHI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea?
The IUPAC name of (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea (CID 70802426) is (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea.
What is the SMILES notation for (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea?
The canonical SMILES for (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea is CCC1CC=C(CNC(N)=O)C=C1Cl.
What is the InChIKey of (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea?
The InChIKey is CQZJNOXVVAPGHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2O/c1-2-8-4-3-7(5-9(8)11)6-13-10(12)14/h3,5,8H,2,4,6H2,1H3,(H3,12,13,14).
What are the key properties of (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea?
(5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea has a molecular weight of 214.70 g/mol, XLogP of 2.13, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-4-ethylcyclohexa-1,5-dien-1-yl)methylurea is sourced from PubChem (CID 70802426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).