About cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol
cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol (PubChem CID 70803199) has the molecular formula C23H32O2Si
and a molecular weight of 368.59 g/mol. Its IUPAC name is cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol |
| PubChem CID | 70803199 |
| Molecular Formula | C23H32O2Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol |
| SMILES | CC([C@H]1CCCC[C@H]1O)C(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H32O2Si/c1-18(21-16-10-11-17-22(21)24)23(2,3)26(25,19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-9,12-15,18,21-22,24-25H,10-11,16-17H2,1-3H3/t18?,21-,22-/m1/s1 |
| InChIKey | YCLUHYHHMKEIFO-IPKCRJEZSA-N |
| XLogP | 3.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol?
The IUPAC name of cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol (CID 70803199) is cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol.
What is the SMILES notation for cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol?
The canonical SMILES for cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol is CC([C@H]1CCCC[C@H]1O)C(C)(C)[Si](O)(c1ccccc1)c1ccccc1.
What is the InChIKey of cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol?
The InChIKey is YCLUHYHHMKEIFO-IPKCRJEZSA-N. The full InChI is InChI=1S/C23H32O2Si/c1-18(21-16-10-11-17-22(21)24)23(2,3)26(25,19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-9,12-15,18,21-22,24-25H,10-11,16-17H2,1-3H3/t18?,21-,22-/m1/s1.
What are the key properties of cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol?
cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol has a molecular weight of 368.59 g/mol, XLogP of 3.71, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2R)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutan-2-yl]cyclohexan-1-ol is sourced from PubChem (CID 70803199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).