C35H46N2O9S — CID 70803452
methyl 5-tert-butyl-3-[(4-methylcyclohexanecarbonyl)-[4-[(3S,4S)-4-(4-nitrobenzoyl)oxyoxolan-3-yl]oxycyclohexyl]amino]thiophene-2-carboxylate (PubChem CID 70803452) has the molecular formula C35H46N2O9S and a molecular weight of 670.83 g/mol. Its IUPAC name is methyl 5-tert-butyl-3-[(4-methylcyclohexanecarbonyl)-[4-[(3S,4S)-4-(4-nitrobenzoyl)oxyoxolan-3-yl]oxycyclohexyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 5-tert-butyl-3-[(4-methylcyclohexanecarbonyl)-[4-[(3S,4S)-4-(4-nitrobenzoyl)oxyoxolan-3-yl]oxycyclohexyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 70803452 |
| Molecular Formula | C35H46N2O9S |
| Molecular Weight | 670.83 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | methyl 5-tert-butyl-3-[(4-methylcyclohexanecarbonyl)-[4-[(3S,4S)-4-(4-nitrobenzoyl)oxyoxolan-3-yl]oxycyclohexyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(C(C)(C)C)cc1N(C(=O)C1CCC(C)CC1)C1CCC(O[C@H]2COC[C@@H]2OC(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C35H46N2O9S/c1-21-6-8-22(9-7-21)32(38)36(27-18-30(35(2,3)4)47-31(27)34(40)43-5)24-14-16-26(17-15-24)45-28-19-44-20-29(28)46-33(39)23-10-12-25(13-11-23)37(41)42/h10-13,18,21-22,24,26,28-29H,6-9,14-17,19-20H2,1-5H3/t21?,22?,24?,26?,28-,29-/m0/s1 |
| InChIKey | XTYTXDBPEAUEGU-VCLBNZQESA-N |
| XLogP | 6.85 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.83 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|