C14H20F2 — CID 70803524
(4aR)-7-(difluoromethylidene)-3,4,4a-trimethyl-1,2,3,4,5,6-hexahydronaphthalene (PubChem CID 70803524) has the molecular formula C14H20F2 and a molecular weight of 226.31 g/mol. Its IUPAC name is (4aR)-7-(difluoromethylidene)-3,4,4a-trimethyl-1,2,3,4,5,6-hexahydronaphthalene.
| Compound Name | (4aR)-7-(difluoromethylidene)-3,4,4a-trimethyl-1,2,3,4,5,6-hexahydronaphthalene |
|---|---|
| PubChem CID | 70803524 |
| Molecular Formula | C14H20F2 |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (4aR)-7-(difluoromethylidene)-3,4,4a-trimethyl-1,2,3,4,5,6-hexahydronaphthalene |
| SMILES | CC1CCC2=CC(=C(F)F)CC[C@]2(C)C1C |
| InChI | InChI=1S/C14H20F2/c1-9-4-5-12-8-11(13(15)16)6-7-14(12,3)10(9)2/h8-10H,4-7H2,1-3H3/t9?,10?,14-/m1/s1 |
| InChIKey | XKCRPRBUUCGVPM-RPFQZYLTSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |