C13H18F2 — CID 70803527
(8aR)-6,6-difluoro-1,2,8a-trimethyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 70803527) has the molecular formula C13H18F2 and a molecular weight of 212.28 g/mol. Its IUPAC name is (8aR)-6,6-difluoro-1,2,8a-trimethyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (8aR)-6,6-difluoro-1,2,8a-trimethyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 70803527 |
| Molecular Formula | C13H18F2 |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (8aR)-6,6-difluoro-1,2,8a-trimethyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC1CCC2=CC(F)(F)C=C[C@]2(C)C1C |
| InChI | InChI=1S/C13H18F2/c1-9-4-5-11-8-13(14,15)7-6-12(11,3)10(9)2/h6-10H,4-5H2,1-3H3/t9?,10?,12-/m1/s1 |
| InChIKey | BEZGRNAOEGNTLA-RTYFJBAXSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|